C11H24N2O4S — CID 114807123
5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid (PubChem CID 114807123) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid.
| Compound Name | 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 114807123 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid |
| SMILES | CC(C)NS(=O)(=O)NC(CC(=O)O)CC(C)(C)C |
| InChI | InChI=1S/C11H24N2O4S/c1-8(2)12-18(16,17)13-9(6-10(14)15)7-11(3,4)5/h8-9,12-13H,6-7H2,1-5H3,(H,14,15) |
| InChIKey | WLDOLBLCTCIDPA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |