5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid

C11H24N2O4S — CID 114807123

IUPAC5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid
SMILESCC(C)NS(=O)(=O)NC(CC(=O)O)CC(C)(C)C
InChIInChI=1S/C11H24N2O4S/c1-8(2)12-18(16,17)13-9(6-10(14)15)7-11(3,4)5/h8-9,12-13H,6-7H2,1-5H3,(H,14,15)
InChIKeyWLDOLBLCTCIDPA-UHFFFAOYSA-N
MW280.39 g/mol
LogP1.10
Rot. Bonds7

About 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid

5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid (PubChem CID 114807123) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid.

Molecular Properties

Compound Name5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid
PubChem CID114807123
Molecular FormulaC11H24N2O4S
Molecular Weight280.39 g/mol
Exact Mass280.15
IUPAC Name5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid
SMILESCC(C)NS(=O)(=O)NC(CC(=O)O)CC(C)(C)C
InChIInChI=1S/C11H24N2O4S/c1-8(2)12-18(16,17)13-9(6-10(14)15)7-11(3,4)5/h8-9,12-13H,6-7H2,1-5H3,(H,14,15)
InChIKeyWLDOLBLCTCIDPA-UHFFFAOYSA-N
XLogP1.10
TPSA95.50 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.39
LogP ≤ 51.10
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid?
The IUPAC name of 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid (CID 114807123) is 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid.
What is the SMILES notation for 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid?
The canonical SMILES for 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid is CC(C)NS(=O)(=O)NC(CC(=O)O)CC(C)(C)C.
What is the InChIKey of 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid?
The InChIKey is WLDOLBLCTCIDPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O4S/c1-8(2)12-18(16,17)13-9(6-10(14)15)7-11(3,4)5/h8-9,12-13H,6-7H2,1-5H3,(H,14,15).
What are the key properties of 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid?
5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid has a molecular weight of 280.39 g/mol, XLogP of 1.10, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3-(propan-2-ylsulfamoylamino)hexanoic acid is sourced from PubChem (CID 114807123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).