C6H12F3N3O2S2 — CID 114808264
3-(2,2,2-trifluoroethylsulfamoylamino)butanethioamide (PubChem CID 114808264) has the molecular formula C6H12F3N3O2S2 and a molecular weight of 279.31 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethylsulfamoylamino)butanethioamide.
| Compound Name | 3-(2,2,2-trifluoroethylsulfamoylamino)butanethioamide |
|---|---|
| PubChem CID | 114808264 |
| Molecular Formula | C6H12F3N3O2S2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 3-(2,2,2-trifluoroethylsulfamoylamino)butanethioamide |
| SMILES | CC(CC(N)=S)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H12F3N3O2S2/c1-4(2-5(10)15)12-16(13,14)11-3-6(7,8)9/h4,11-12H,2-3H2,1H3,(H2,10,15) |
| InChIKey | BIQYGPMBSIJASK-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|