C5H5BrF3N3O2S2 — CID 114808747
5-bromo-N-(2,2,2-trifluoroethylsulfamoyl)-1,3-thiazol-2-amine (PubChem CID 114808747) has the molecular formula C5H5BrF3N3O2S2 and a molecular weight of 340.15 g/mol. Its IUPAC name is 5-bromo-N-(2,2,2-trifluoroethylsulfamoyl)-1,3-thiazol-2-amine.
| Compound Name | 5-bromo-N-(2,2,2-trifluoroethylsulfamoyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114808747 |
| Molecular Formula | C5H5BrF3N3O2S2 |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 338.90 |
| IUPAC Name | 5-bromo-N-(2,2,2-trifluoroethylsulfamoyl)-1,3-thiazol-2-amine |
| SMILES | O=S(=O)(NCC(F)(F)F)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C5H5BrF3N3O2S2/c6-3-1-10-4(15-3)12-16(13,14)11-2-5(7,8)9/h1,11H,2H2,(H,10,12) |
| InChIKey | MIFMUAOINMUSKP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |