About 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine
7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine (PubChem CID 114811036) has the molecular formula C8H17N3O3S
and a molecular weight of 235.31 g/mol. Its IUPAC name is 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine.
Molecular Properties
| Compound Name | 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine |
| PubChem CID | 114811036 |
| Molecular Formula | C8H17N3O3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine |
| SMILES | CCNS(=O)(=O)NC1C(N)C2CCOC21 |
| InChI | InChI=1S/C8H17N3O3S/c1-2-10-15(12,13)11-7-6(9)5-3-4-14-8(5)7/h5-8,10-11H,2-4,9H2,1H3 |
| InChIKey | IETZODRVFSYFIU-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine?
The IUPAC name of 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine (CID 114811036) is 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine.
What is the SMILES notation for 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine?
The canonical SMILES for 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine is CCNS(=O)(=O)NC1C(N)C2CCOC21.
What is the InChIKey of 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine?
The InChIKey is IETZODRVFSYFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O3S/c1-2-10-15(12,13)11-7-6(9)5-3-4-14-8(5)7/h5-8,10-11H,2-4,9H2,1H3.
What are the key properties of 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine?
7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine has a molecular weight of 235.31 g/mol, XLogP of -1.46, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-N-(ethylsulfamoyl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine is sourced from PubChem (CID 114811036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).