C9H15N3O3S — CID 66212129
N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-1-cyanomethanesulfonamide (PubChem CID 66212129) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-1-cyanomethanesulfonamide.
| Compound Name | N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-1-cyanomethanesulfonamide |
|---|---|
| PubChem CID | 66212129 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-1-cyanomethanesulfonamide |
| SMILES | N#CCS(=O)(=O)NC1C(N)C2CCCOC21 |
| InChI | InChI=1S/C9H15N3O3S/c10-3-5-16(13,14)12-8-7(11)6-2-1-4-15-9(6)8/h6-9,12H,1-2,4-5,11H2 |
| InChIKey | BFIAVBQSALPGKI-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |