C11H20N2O5S — CID 66195757
methyl 4-[(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)sulfamoyl]butanoate (PubChem CID 66195757) has the molecular formula C11H20N2O5S and a molecular weight of 292.36 g/mol. Its IUPAC name is methyl 4-[(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 66195757 |
| Molecular Formula | C11H20N2O5S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl 4-[(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NC1C(N)C2CCOC21 |
| InChI | InChI=1S/C11H20N2O5S/c1-17-8(14)3-2-6-19(15,16)13-10-9(12)7-4-5-18-11(7)10/h7,9-11,13H,2-6,12H2,1H3 |
| InChIKey | PAFJISVCRTXVPR-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |