C12H22N2O5S — CID 66212712
methyl 4-[(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)sulfamoyl]butanoate (PubChem CID 66212712) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is methyl 4-[(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 66212712 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | methyl 4-[(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NC1C(N)C2CCCOC21 |
| InChI | InChI=1S/C12H22N2O5S/c1-18-9(15)5-3-7-20(16,17)14-11-10(13)8-4-2-6-19-12(8)11/h8,10-12,14H,2-7,13H2,1H3 |
| InChIKey | HBFFGOILOGNQSQ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |