C12H16O3 — CID 11481192
8-methoxy-4,7-dimethyl-3,4-dihydro-2H-chromen-2-ol (PubChem CID 11481192) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 8-methoxy-4,7-dimethyl-3,4-dihydro-2H-chromen-2-ol.
| Compound Name | 8-methoxy-4,7-dimethyl-3,4-dihydro-2H-chromen-2-ol |
|---|---|
| PubChem CID | 11481192 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 8-methoxy-4,7-dimethyl-3,4-dihydro-2H-chromen-2-ol |
| SMILES | COc1c(C)ccc2c1OC(O)CC2C |
| InChI | InChI=1S/C12H16O3/c1-7-4-5-9-8(2)6-10(13)15-12(9)11(7)14-3/h4-5,8,10,13H,6H2,1-3H3 |
| InChIKey | NUCBLINRDJNOPU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |