C22H26O5 — CID 59656257
(2S)-2-(3,4,5-trimethoxyphenyl)-3,4,7,8,9,10-hexahydro-2H-benzo[h]chromen-4-ol (PubChem CID 59656257) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is (2S)-2-(3,4,5-trimethoxyphenyl)-3,4,7,8,9,10-hexahydro-2H-benzo[h]chromen-4-ol.
| Compound Name | (2S)-2-(3,4,5-trimethoxyphenyl)-3,4,7,8,9,10-hexahydro-2H-benzo[h]chromen-4-ol |
|---|---|
| PubChem CID | 59656257 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (2S)-2-(3,4,5-trimethoxyphenyl)-3,4,7,8,9,10-hexahydro-2H-benzo[h]chromen-4-ol |
| SMILES | COc1cc([C@@H]2CC(O)c3ccc4c(c3O2)CCCC4)cc(OC)c1OC |
| InChI | InChI=1S/C22H26O5/c1-24-19-10-14(11-20(25-2)22(19)26-3)18-12-17(23)16-9-8-13-6-4-5-7-15(13)21(16)27-18/h8-11,17-18,23H,4-7,12H2,1-3H3/t17?,18-/m0/s1 |
| InChIKey | FHUYHNWRQBQCFJ-ZVAWYAOSSA-N |
| XLogP | 4.15 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |