C19H18O — CID 174384948
6-methoxy-1,2,3,4-tetrahydrochrysene (PubChem CID 174384948) has the molecular formula C19H18O and a molecular weight of 262.35 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4-tetrahydrochrysene.
| Compound Name | 6-methoxy-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174384948 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 6-methoxy-1,2,3,4-tetrahydrochrysene |
| SMILES | COc1cc2c3c(ccc2c2ccccc12)CCCC3 |
| InChI | InChI=1S/C19H18O/c1-20-19-12-18-14-7-3-2-6-13(14)10-11-16(18)15-8-4-5-9-17(15)19/h4-5,8-12H,2-3,6-7H2,1H3 |
| InChIKey | GTOWKJARLJZTDQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|