C10H15F2N3O2S — CID 114814126
4,6-difluoro-3-N-(2-methylpropylsulfamoyl)benzene-1,3-diamine (PubChem CID 114814126) has the molecular formula C10H15F2N3O2S and a molecular weight of 279.31 g/mol. Its IUPAC name is 4,6-difluoro-3-N-(2-methylpropylsulfamoyl)benzene-1,3-diamine.
| Compound Name | 4,6-difluoro-3-N-(2-methylpropylsulfamoyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 114814126 |
| Molecular Formula | C10H15F2N3O2S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4,6-difluoro-3-N-(2-methylpropylsulfamoyl)benzene-1,3-diamine |
| SMILES | CC(C)CNS(=O)(=O)Nc1cc(N)c(F)cc1F |
| InChI | InChI=1S/C10H15F2N3O2S/c1-6(2)5-14-18(16,17)15-10-4-9(13)7(11)3-8(10)12/h3-4,6,14-15H,5,13H2,1-2H3 |
| InChIKey | JBHIZDFCCRDVNL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|