C6H15ClN2O4S — CID 11482003
[(1S)-1-carboxy-5-sulfamoylpentyl]azanium chloride (PubChem CID 11482003) has the molecular formula C6H15ClN2O4S and a molecular weight of 246.72 g/mol. Its IUPAC name is [(1S)-1-carboxy-5-sulfamoylpentyl]azanium chloride.
| Compound Name | [(1S)-1-carboxy-5-sulfamoylpentyl]azanium chloride |
|---|---|
| PubChem CID | 11482003 |
| Molecular Formula | C6H15ClN2O4S |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | [(1S)-1-carboxy-5-sulfamoylpentyl]azanium chloride |
| SMILES | NS(=O)(=O)CCCC[C@H]([NH3+])C(=O)O.[Cl-] |
| InChI | InChI=1S/C6H14N2O4S.ClH/c7-5(6(9)10)3-1-2-4-13(8,11)12;/h5H,1-4,7H2,(H,9,10)(H2,8,11,12);1H/t5-;/m0./s1 |
| InChIKey | CQCWTVGOMSWJKD-JEDNCBNOSA-N |
| XLogP | -4.86 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|