C11H10N2OS2 — CID 11482099
1-[4-(4-methylphenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]ethanone (PubChem CID 11482099) has the molecular formula C11H10N2OS2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 1-[4-(4-methylphenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]ethanone.
| Compound Name | 1-[4-(4-methylphenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 11482099 |
| Molecular Formula | C11H10N2OS2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 1-[4-(4-methylphenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]ethanone |
| SMILES | CC(=O)c1nn(-c2ccc(C)cc2)c(=S)s1 |
| InChI | InChI=1S/C11H10N2OS2/c1-7-3-5-9(6-4-7)13-11(15)16-10(12-13)8(2)14/h3-6H,1-2H3 |
| InChIKey | HFQBSSIQNCIHEJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|