C12H16O4S — CID 11482262
benzyl 2-[(2R)-2,3-dihydroxypropyl]sulfanylacetate (PubChem CID 11482262) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is benzyl 2-[(2R)-2,3-dihydroxypropyl]sulfanylacetate.
| Compound Name | benzyl 2-[(2R)-2,3-dihydroxypropyl]sulfanylacetate |
|---|---|
| PubChem CID | 11482262 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | benzyl 2-[(2R)-2,3-dihydroxypropyl]sulfanylacetate |
| SMILES | O=C(CSC[C@H](O)CO)OCc1ccccc1 |
| InChI | InChI=1S/C12H16O4S/c13-6-11(14)8-17-9-12(15)16-7-10-4-2-1-3-5-10/h1-5,11,13-14H,6-9H2/t11-/m1/s1 |
| InChIKey | VFONFPRIZJEDQO-LLVKDONJSA-N |
| XLogP | 0.82 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |