C7H10ClF3O2S — CID 114827468
1-cyclopentyl-2,2,2-trifluoroethanesulfonyl chloride (PubChem CID 114827468) has the molecular formula C7H10ClF3O2S and a molecular weight of 250.67 g/mol. Its IUPAC name is 1-cyclopentyl-2,2,2-trifluoroethanesulfonyl chloride.
| Compound Name | 1-cyclopentyl-2,2,2-trifluoroethanesulfonyl chloride |
|---|---|
| PubChem CID | 114827468 |
| Molecular Formula | C7H10ClF3O2S |
| Molecular Weight | 250.67 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1-cyclopentyl-2,2,2-trifluoroethanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)C(C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C7H10ClF3O2S/c8-14(12,13)6(7(9,10)11)5-3-1-2-4-5/h5-6H,1-4H2 |
| InChIKey | VBCQWDJMEHGHMU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.67 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |