C7H12F3NO3S — CID 114827695
2,2,2-trifluoro-1-(oxan-4-yl)ethanesulfonamide (PubChem CID 114827695) has the molecular formula C7H12F3NO3S and a molecular weight of 247.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(oxan-4-yl)ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-1-(oxan-4-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 114827695 |
| Molecular Formula | C7H12F3NO3S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2,2,2-trifluoro-1-(oxan-4-yl)ethanesulfonamide |
| SMILES | NS(=O)(=O)C(C1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO3S/c8-7(9,10)6(15(11,12)13)5-1-3-14-4-2-5/h5-6H,1-4H2,(H2,11,12,13) |
| InChIKey | USMNUAAIXGJYLD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |