C7H10ClF3O3S — CID 114827559
2,2,2-trifluoro-1-(oxan-4-yl)ethanesulfonyl chloride (PubChem CID 114827559) has the molecular formula C7H10ClF3O3S and a molecular weight of 266.67 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(oxan-4-yl)ethanesulfonyl chloride.
| Compound Name | 2,2,2-trifluoro-1-(oxan-4-yl)ethanesulfonyl chloride |
|---|---|
| PubChem CID | 114827559 |
| Molecular Formula | C7H10ClF3O3S |
| Molecular Weight | 266.67 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 2,2,2-trifluoro-1-(oxan-4-yl)ethanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)C(C1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C7H10ClF3O3S/c8-15(12,13)6(7(9,10)11)5-1-3-14-4-2-5/h5-6H,1-4H2 |
| InChIKey | VYMRYJIQOXUXKM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.67 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |