C16H24O5 — CID 11483328
[5-[(1S,2S)-1-hydroxy-2-methyl-3-oxooctyl]furan-2-yl]methyl acetate (PubChem CID 11483328) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is [5-[(1S,2S)-1-hydroxy-2-methyl-3-oxooctyl]furan-2-yl]methyl acetate.
| Compound Name | [5-[(1S,2S)-1-hydroxy-2-methyl-3-oxooctyl]furan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11483328 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | [5-[(1S,2S)-1-hydroxy-2-methyl-3-oxooctyl]furan-2-yl]methyl acetate |
| SMILES | CCCCCC(=O)[C@@H](C)[C@H](O)c1ccc(COC(C)=O)o1 |
| InChI | InChI=1S/C16H24O5/c1-4-5-6-7-14(18)11(2)16(19)15-9-8-13(21-15)10-20-12(3)17/h8-9,11,16,19H,4-7,10H2,1-3H3/t11-,16+/m1/s1 |
| InChIKey | WJFZQYMDNWCHIW-BZNIZROVSA-N |
| XLogP | 3.16 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|