C20H18O2Si — CID 11483984
1-[2-[2-(3-hydroxyphenyl)ethynyl]phenyl]-3-trimethylsilylprop-2-yn-1-one (PubChem CID 11483984) has the molecular formula C20H18O2Si and a molecular weight of 318.45 g/mol. Its IUPAC name is 1-[2-[2-(3-hydroxyphenyl)ethynyl]phenyl]-3-trimethylsilylprop-2-yn-1-one.
| Compound Name | 1-[2-[2-(3-hydroxyphenyl)ethynyl]phenyl]-3-trimethylsilylprop-2-yn-1-one |
|---|---|
| PubChem CID | 11483984 |
| Molecular Formula | C20H18O2Si |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-[2-[2-(3-hydroxyphenyl)ethynyl]phenyl]-3-trimethylsilylprop-2-yn-1-one |
| SMILES | C[Si](C)(C)C#CC(=O)c1ccccc1C#Cc1cccc(O)c1 |
| InChI | InChI=1S/C20H18O2Si/c1-23(2,3)14-13-20(22)19-10-5-4-8-17(19)12-11-16-7-6-9-18(21)15-16/h4-10,15,21H,1-3H3 |
| InChIKey | ALFVKALBSOHXJO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|