About 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid
2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid (PubChem CID 11484212) has the molecular formula C18H34O3Si
and a molecular weight of 326.55 g/mol. Its IUPAC name is 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid |
| PubChem CID | 11484212 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid |
| SMILES | C=C1[C@H](CC(=O)O)CCC[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H34O3Si/c1-12(2)22(13(3)4,14(5)6)21-17-10-8-9-16(15(17)7)11-18(19)20/h12-14,16-17H,7-11H2,1-6H3,(H,19,20)/t16-,17+/m0/s1 |
| InChIKey | FTIWNYYRPPBLMY-DLBZAZTESA-N |
| XLogP | 5.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid?
The IUPAC name of 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid (CID 11484212) is 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid.
What is the SMILES notation for 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid?
The canonical SMILES for 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid is C=C1[C@H](CC(=O)O)CCC[C@H]1O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid?
The InChIKey is FTIWNYYRPPBLMY-DLBZAZTESA-N. The full InChI is InChI=1S/C18H34O3Si/c1-12(2)22(13(3)4,14(5)6)21-17-10-8-9-16(15(17)7)11-18(19)20/h12-14,16-17H,7-11H2,1-6H3,(H,19,20)/t16-,17+/m0/s1.
What are the key properties of 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid?
2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid has a molecular weight of 326.55 g/mol, XLogP of 5.38, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,3R)-2-methylidene-3-tri(propan-2-yl)silyloxycyclohexyl]acetic acid is sourced from PubChem (CID 11484212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).