C15H24NO6P — CID 11484744
tert-butyl N-[(Z)-1-diethoxyphosphoryl-2-(furan-2-yl)ethenyl]carbamate (PubChem CID 11484744) has the molecular formula C15H24NO6P and a molecular weight of 345.33 g/mol. Its IUPAC name is tert-butyl N-[(Z)-1-diethoxyphosphoryl-2-(furan-2-yl)ethenyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-1-diethoxyphosphoryl-2-(furan-2-yl)ethenyl]carbamate |
|---|---|
| PubChem CID | 11484744 |
| Molecular Formula | C15H24NO6P |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | tert-butyl N-[(Z)-1-diethoxyphosphoryl-2-(furan-2-yl)ethenyl]carbamate |
| SMILES | CCOP(=O)(OCC)/C(=C\c1ccco1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24NO6P/c1-6-20-23(18,21-7-2)13(11-12-9-8-10-19-12)16-14(17)22-15(3,4)5/h8-11H,6-7H2,1-5H3,(H,16,17)/b13-11- |
| InChIKey | QSXYLECQRULSQT-QBFSEMIESA-N |
| XLogP | 4.37 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|