C9H5ClN2OS2 — CID 114863636
4-chloro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde (PubChem CID 114863636) has the molecular formula C9H5ClN2OS2 and a molecular weight of 256.74 g/mol. Its IUPAC name is 4-chloro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde.
| Compound Name | 4-chloro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 114863636 |
| Molecular Formula | C9H5ClN2OS2 |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | 4-chloro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde |
| SMILES | O=Cc1ccc(Cl)cc1Sc1nncs1 |
| InChI | InChI=1S/C9H5ClN2OS2/c10-7-2-1-6(4-13)8(3-7)15-9-12-11-5-14-9/h1-5H |
| InChIKey | JQDHMHLTCOWLHC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|