C16H26O2 — CID 114866082
4-(4-methoxy-2,5-dimethylphenyl)heptan-4-ol (PubChem CID 114866082) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 4-(4-methoxy-2,5-dimethylphenyl)heptan-4-ol.
| Compound Name | 4-(4-methoxy-2,5-dimethylphenyl)heptan-4-ol |
|---|---|
| PubChem CID | 114866082 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 4-(4-methoxy-2,5-dimethylphenyl)heptan-4-ol |
| SMILES | CCCC(O)(CCC)c1cc(C)c(OC)cc1C |
| InChI | InChI=1S/C16H26O2/c1-6-8-16(17,9-7-2)14-10-13(4)15(18-5)11-12(14)3/h10-11,17H,6-9H2,1-5H3 |
| InChIKey | WDQXAIQMLVNDSD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |