C24H27NO5 — CID 11486656
methyl (1R,2R,3S)-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-3-(4-methoxyphenyl)-2-methylcyclopropane-1-carboxylate (PubChem CID 11486656) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is methyl (1R,2R,3S)-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-3-(4-methoxyphenyl)-2-methylcyclopropane-1-carboxylate.
| Compound Name | methyl (1R,2R,3S)-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-3-(4-methoxyphenyl)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11486656 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | methyl (1R,2R,3S)-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-3-(4-methoxyphenyl)-2-methylcyclopropane-1-carboxylate |
| SMILES | COC[C@@H]1N=C([C@@]2(C)[C@H](C(=O)OC)[C@H]2c2ccc(OC)cc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H27NO5/c1-24(19(20(24)22(26)29-4)15-10-12-17(28-3)13-11-15)23-25-18(14-27-2)21(30-23)16-8-6-5-7-9-16/h5-13,18-21H,14H2,1-4H3/t18-,19+,20-,21-,24+/m0/s1 |
| InChIKey | JAWIRMBKMARANJ-BBMMYNIISA-N |
| XLogP | 3.77 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |