About 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine
4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine (PubChem CID 114867657) has the molecular formula C16H34N2O
and a molecular weight of 270.46 g/mol. Its IUPAC name is 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine.
Molecular Properties
| Compound Name | 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine |
| PubChem CID | 114867657 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine |
| SMILES | CC(C)CC(CN)(CC(C)C)N1CCCOC(C)C1 |
| InChI | InChI=1S/C16H34N2O/c1-13(2)9-16(12-17,10-14(3)4)18-7-6-8-19-15(5)11-18/h13-15H,6-12,17H2,1-5H3 |
| InChIKey | BYKKELAEWCLONZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine?
The IUPAC name of 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine (CID 114867657) is 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine.
What is the SMILES notation for 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine?
The canonical SMILES for 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine is CC(C)CC(CN)(CC(C)C)N1CCCOC(C)C1.
What is the InChIKey of 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine?
The InChIKey is BYKKELAEWCLONZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2O/c1-13(2)9-16(12-17,10-14(3)4)18-7-6-8-19-15(5)11-18/h13-15H,6-12,17H2,1-5H3.
What are the key properties of 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine?
4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine has a molecular weight of 270.46 g/mol, XLogP of 2.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(2-methyl-1,4-oxazepan-4-yl)-2-(2-methylpropyl)pentan-1-amine is sourced from PubChem (CID 114867657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).