C25H50O3Si — CID 11487142
[(E,3R,7S,9R)-10-[tert-butyl(dimethyl)silyl]oxy-3,5,7,9-tetramethyldec-4-enyl] 2,2-dimethylpropanoate (PubChem CID 11487142) has the molecular formula C25H50O3Si and a molecular weight of 426.76 g/mol. Its IUPAC name is [(E,3R,7S,9R)-10-[tert-butyl(dimethyl)silyl]oxy-3,5,7,9-tetramethyldec-4-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,3R,7S,9R)-10-[tert-butyl(dimethyl)silyl]oxy-3,5,7,9-tetramethyldec-4-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11487142 |
| Molecular Formula | C25H50O3Si |
| Molecular Weight | 426.76 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | [(E,3R,7S,9R)-10-[tert-butyl(dimethyl)silyl]oxy-3,5,7,9-tetramethyldec-4-enyl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\[C@H](C)CCOC(=O)C(C)(C)C)C[C@@H](C)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O3Si/c1-19(13-14-27-23(26)24(5,6)7)15-20(2)16-21(3)17-22(4)18-28-29(11,12)25(8,9)10/h15,19,21-22H,13-14,16-18H2,1-12H3/b20-15+/t19-,21-,22-/m1/s1 |
| InChIKey | FJFIFUZXPBGKCR-KEJYZEFESA-N |
| XLogP | 7.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.76 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|