C24H24N4O4 — CID 11487294
(2R)-2-azido-2-[4-methoxy-3,5-bis(phenylmethoxy)phenyl]-N-methylacetamide (PubChem CID 11487294) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is (2R)-2-azido-2-[4-methoxy-3,5-bis(phenylmethoxy)phenyl]-N-methylacetamide.
| Compound Name | (2R)-2-azido-2-[4-methoxy-3,5-bis(phenylmethoxy)phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 11487294 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (2R)-2-azido-2-[4-methoxy-3,5-bis(phenylmethoxy)phenyl]-N-methylacetamide |
| SMILES | CNC(=O)[C@H](N=[N+]=[N-])c1cc(OCc2ccccc2)c(OC)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H24N4O4/c1-26-24(29)22(27-28-25)19-13-20(31-15-17-9-5-3-6-10-17)23(30-2)21(14-19)32-16-18-11-7-4-8-12-18/h3-14,22H,15-16H2,1-2H3,(H,26,29)/t22-/m1/s1 |
| InChIKey | VNNBMADAMPLPNS-JOCHJYFZSA-N |
| XLogP | 4.95 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|