C23H15ClF3N3O2 — CID 11487933
N-[(4-chlorophenyl)methyl]-3-oxo-4-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide (PubChem CID 11487933) has the molecular formula C23H15ClF3N3O2 and a molecular weight of 457.84 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-oxo-4-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-oxo-4-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 11487933 |
| Molecular Formula | C23H15ClF3N3O2 |
| Molecular Weight | 457.84 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-oxo-4-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1nc2ccccc2n(-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C23H15ClF3N3O2/c24-16-10-8-14(9-11-16)13-28-21(31)20-22(32)30(19-7-2-1-6-18(19)29-20)17-5-3-4-15(12-17)23(25,26)27/h1-12H,13H2,(H,28,31) |
| InChIKey | ZSCLCNVLKRJCFF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.84 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |