C25H27F3N4O2 — CID 69144994
N-[3-(azepan-1-yl)propyl]-3-oxo-4-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide (PubChem CID 69144994) has the molecular formula C25H27F3N4O2 and a molecular weight of 472.51 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-3-oxo-4-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-3-oxo-4-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 69144994 |
| Molecular Formula | C25H27F3N4O2 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-3-oxo-4-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide |
| SMILES | O=C(NCCCN1CCCCCC1)c1nc2ccccc2n(-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C25H27F3N4O2/c26-25(27,28)18-9-7-10-19(17-18)32-21-12-4-3-11-20(21)30-22(24(32)34)23(33)29-13-8-16-31-14-5-1-2-6-15-31/h3-4,7,9-12,17H,1-2,5-6,8,13-16H2,(H,29,33) |
| InChIKey | AZIYFUDYRQQVCB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|