C24H29F3N4O4 — CID 68881140
3-N,3-N,2-trimethyl-5-N-(3-morpholin-4-ylpropyl)-6-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3,5-dicarboxamide (PubChem CID 68881140) has the molecular formula C24H29F3N4O4 and a molecular weight of 494.51 g/mol. Its IUPAC name is 3-N,3-N,2-trimethyl-5-N-(3-morpholin-4-ylpropyl)-6-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3,5-dicarboxamide.
| Compound Name | 3-N,3-N,2-trimethyl-5-N-(3-morpholin-4-ylpropyl)-6-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 68881140 |
| Molecular Formula | C24H29F3N4O4 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 3-N,3-N,2-trimethyl-5-N-(3-morpholin-4-ylpropyl)-6-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3,5-dicarboxamide |
| SMILES | Cc1c(C(=O)N(C)C)cc(C(=O)NCCCN2CCOCC2)c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H29F3N4O4/c1-16-19(22(33)29(2)3)15-20(21(32)28-8-5-9-30-10-12-35-13-11-30)23(34)31(16)18-7-4-6-17(14-18)24(25,26)27/h4,6-7,14-15H,5,8-13H2,1-3H3,(H,28,32) |
| InChIKey | UQVZCTNXOQSEAQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|