C29H41N2O12PS — CID 11490840
bis(2,6-dimethylpyridine);[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylmethylphosphonic acid (PubChem CID 11490840) has the molecular formula C29H41N2O12PS and a molecular weight of 672.69 g/mol. Its IUPAC name is bis(2,6-dimethylpyridine);[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylmethylphosphonic acid.
| Compound Name | bis(2,6-dimethylpyridine);[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylmethylphosphonic acid |
|---|---|
| PubChem CID | 11490840 |
| Molecular Formula | C29H41N2O12PS |
| Molecular Weight | 672.69 g/mol |
| Exact Mass | 672.21 |
| IUPAC Name | bis(2,6-dimethylpyridine);[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylmethylphosphonic acid |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SCP(=O)(O)O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O.Cc1cccc(C)n1.Cc1cccc(C)n1 |
| InChI | InChI=1S/C15H23O12PS.2C7H9N/c1-7(16)23-5-11-12(24-8(2)17)13(25-9(3)18)14(26-10(4)19)15(27-11)29-6-28(20,21)22;2*1-6-4-3-5-7(2)8-6/h11-15H,5-6H2,1-4H3,(H2,20,21,22);2*3-5H,1-2H3/t11-,12-,13+,14-,15+;;/m1../s1 |
| InChIKey | CMJWJGWSASXHTG-FAPGYOJYSA-N |
| XLogP | 3.33 |
| TPSA | 197.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|