C11H7NO2S — CID 114911013
3-(1-benzothiophen-2-yl)-4H-1,2-oxazol-5-one (PubChem CID 114911013) has the molecular formula C11H7NO2S and a molecular weight of 217.25 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-yl)-4H-1,2-oxazol-5-one.
| Compound Name | 3-(1-benzothiophen-2-yl)-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 114911013 |
| Molecular Formula | C11H7NO2S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 3-(1-benzothiophen-2-yl)-4H-1,2-oxazol-5-one |
| SMILES | O=C1CC(c2cc3ccccc3s2)=NO1 |
| InChI | InChI=1S/C11H7NO2S/c13-11-6-8(12-14-11)10-5-7-3-1-2-4-9(7)15-10/h1-5H,6H2 |
| InChIKey | AMBSVAOYEAYSBG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|