C12H10OS — CID 135169502
5-(1-benzothiophen-2-yl)-2,3-dihydrofuran (PubChem CID 135169502) has the molecular formula C12H10OS and a molecular weight of 202.28 g/mol. Its IUPAC name is 5-(1-benzothiophen-2-yl)-2,3-dihydrofuran.
| Compound Name | 5-(1-benzothiophen-2-yl)-2,3-dihydrofuran |
|---|---|
| PubChem CID | 135169502 |
| Molecular Formula | C12H10OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 5-(1-benzothiophen-2-yl)-2,3-dihydrofuran |
| SMILES | C1=C(c2cc3ccccc3s2)OCC1 |
| InChI | InChI=1S/C12H10OS/c1-2-6-11-9(4-1)8-12(14-11)10-5-3-7-13-10/h1-2,4-6,8H,3,7H2 |
| InChIKey | UYSQVCBDGCIEKK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |