C8H11N5O3S2 — CID 114913395
2-[4-(thiatriazol-5-ylcarbamoyl)thiomorpholin-3-yl]acetic acid (PubChem CID 114913395) has the molecular formula C8H11N5O3S2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[4-(thiatriazol-5-ylcarbamoyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(thiatriazol-5-ylcarbamoyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 114913395 |
| Molecular Formula | C8H11N5O3S2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-[4-(thiatriazol-5-ylcarbamoyl)thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)Nc1nnns1 |
| InChI | InChI=1S/C8H11N5O3S2/c14-6(15)3-5-4-17-2-1-13(5)8(16)9-7-10-11-12-18-7/h5H,1-4H2,(H,14,15)(H,9,10,12,16) |
| InChIKey | FICLIGAZYUZRFH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |