C9H8FN5OS — CID 114914408
3-fluoro-2-(methylamino)-N-(thiatriazol-5-yl)benzamide (PubChem CID 114914408) has the molecular formula C9H8FN5OS and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-fluoro-2-(methylamino)-N-(thiatriazol-5-yl)benzamide.
| Compound Name | 3-fluoro-2-(methylamino)-N-(thiatriazol-5-yl)benzamide |
|---|---|
| PubChem CID | 114914408 |
| Molecular Formula | C9H8FN5OS |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 3-fluoro-2-(methylamino)-N-(thiatriazol-5-yl)benzamide |
| SMILES | CNc1c(F)cccc1C(=O)Nc1nnns1 |
| InChI | InChI=1S/C9H8FN5OS/c1-11-7-5(3-2-4-6(7)10)8(16)12-9-13-14-15-17-9/h2-4,11H,1H3,(H,12,13,15,16) |
| InChIKey | DBYMWGWQKHDEDW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |