C13H13BrN2O3S — CID 114914813
3-[(4-bromo-1-ethylpyrrole-2-carbonyl)amino]-4-methylthiophene-2-carboxylic acid (PubChem CID 114914813) has the molecular formula C13H13BrN2O3S and a molecular weight of 357.23 g/mol. Its IUPAC name is 3-[(4-bromo-1-ethylpyrrole-2-carbonyl)amino]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-[(4-bromo-1-ethylpyrrole-2-carbonyl)amino]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114914813 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 3-[(4-bromo-1-ethylpyrrole-2-carbonyl)amino]-4-methylthiophene-2-carboxylic acid |
| SMILES | CCn1cc(Br)cc1C(=O)Nc1c(C)csc1C(=O)O |
| InChI | InChI=1S/C13H13BrN2O3S/c1-3-16-5-8(14)4-9(16)12(17)15-10-7(2)6-20-11(10)13(18)19/h4-6H,3H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | ZJEQZCOSWPRUHE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |