C12H12BrN3O2S — CID 54877612
4-bromo-N-(3-carbamoylthiophen-2-yl)-1-ethylpyrrole-2-carboxamide (PubChem CID 54877612) has the molecular formula C12H12BrN3O2S and a molecular weight of 342.22 g/mol. Its IUPAC name is 4-bromo-N-(3-carbamoylthiophen-2-yl)-1-ethylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(3-carbamoylthiophen-2-yl)-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 54877612 |
| Molecular Formula | C12H12BrN3O2S |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 4-bromo-N-(3-carbamoylthiophen-2-yl)-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C12H12BrN3O2S/c1-2-16-6-7(13)5-9(16)11(18)15-12-8(10(14)17)3-4-19-12/h3-6H,2H2,1H3,(H2,14,17)(H,15,18) |
| InChIKey | JKYCTKGTJCZRPS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |