C11H10BrNO4S3 — CID 114915305
3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-4-methylthiophene-2-carboxylic acid (PubChem CID 114915305) has the molecular formula C11H10BrNO4S3 and a molecular weight of 396.31 g/mol. Its IUPAC name is 3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114915305 |
| Molecular Formula | C11H10BrNO4S3 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 394.90 |
| IUPAC Name | 3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)Nc2c(C)csc2C(=O)O)sc1Br |
| InChI | InChI=1S/C11H10BrNO4S3/c1-5-3-7(19-10(5)12)20(16,17)13-8-6(2)4-18-9(8)11(14)15/h3-4,13H,1-2H3,(H,14,15) |
| InChIKey | SJPORSSHPRZGHA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |