C13H8F2N2 — CID 11492336
(Z)-2-(3,4-difluorophenyl)-3-(1H-pyrrol-2-yl)prop-2-enenitrile (PubChem CID 11492336) has the molecular formula C13H8F2N2 and a molecular weight of 230.22 g/mol. Its IUPAC name is (Z)-2-(3,4-difluorophenyl)-3-(1H-pyrrol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(3,4-difluorophenyl)-3-(1H-pyrrol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 11492336 |
| Molecular Formula | C13H8F2N2 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | (Z)-2-(3,4-difluorophenyl)-3-(1H-pyrrol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc[nH]1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H8F2N2/c14-12-4-3-9(7-13(12)15)10(8-16)6-11-2-1-5-17-11/h1-7,17H/b10-6+ |
| InChIKey | NSKZZJWQRHOSRT-UXBLZVDNSA-N |
| XLogP | 3.36 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|