About [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine
[5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine (PubChem CID 114926415) has the molecular formula C15H16ClN3O
and a molecular weight of 289.77 g/mol. Its IUPAC name is [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine |
| PubChem CID | 114926415 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine |
| SMILES | NCc1cc(N2CCOc3ccccc3C2)ncc1Cl |
| InChI | InChI=1S/C15H16ClN3O/c16-13-9-18-15(7-12(13)8-17)19-5-6-20-14-4-2-1-3-11(14)10-19/h1-4,7,9H,5-6,8,10,17H2 |
| InChIKey | ZSDIBHQWCZDSFY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine?
The IUPAC name of [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine (CID 114926415) is [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine.
What is the SMILES notation for [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine?
The canonical SMILES for [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine is NCc1cc(N2CCOc3ccccc3C2)ncc1Cl.
What is the InChIKey of [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine?
The InChIKey is ZSDIBHQWCZDSFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClN3O/c16-13-9-18-15(7-12(13)8-17)19-5-6-20-14-4-2-1-3-11(14)10-19/h1-4,7,9H,5-6,8,10,17H2.
What are the key properties of [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine?
[5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine has a molecular weight of 289.77 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-pyridinyl]methanamine is sourced from PubChem (CID 114926415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).