C15H20F2O2 — CID 114931082
3-[(2,6-difluorophenyl)methyl]-2,2,5,5-tetramethyloxolan-3-ol (PubChem CID 114931082) has the molecular formula C15H20F2O2 and a molecular weight of 270.32 g/mol. Its IUPAC name is 3-[(2,6-difluorophenyl)methyl]-2,2,5,5-tetramethyloxolan-3-ol.
| Compound Name | 3-[(2,6-difluorophenyl)methyl]-2,2,5,5-tetramethyloxolan-3-ol |
|---|---|
| PubChem CID | 114931082 |
| Molecular Formula | C15H20F2O2 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3-[(2,6-difluorophenyl)methyl]-2,2,5,5-tetramethyloxolan-3-ol |
| SMILES | CC1(C)CC(O)(Cc2c(F)cccc2F)C(C)(C)O1 |
| InChI | InChI=1S/C15H20F2O2/c1-13(2)9-15(18,14(3,4)19-13)8-10-11(16)6-5-7-12(10)17/h5-7,18H,8-9H2,1-4H3 |
| InChIKey | FDUCHAYWRQANSN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |