C15H22FNO2 — CID 79928702
[3-(3-fluoroanilino)-2,2,5,5-tetramethyloxolan-3-yl]methanol (PubChem CID 79928702) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is [3-(3-fluoroanilino)-2,2,5,5-tetramethyloxolan-3-yl]methanol.
| Compound Name | [3-(3-fluoroanilino)-2,2,5,5-tetramethyloxolan-3-yl]methanol |
|---|---|
| PubChem CID | 79928702 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | [3-(3-fluoroanilino)-2,2,5,5-tetramethyloxolan-3-yl]methanol |
| SMILES | CC1(C)CC(CO)(Nc2cccc(F)c2)C(C)(C)O1 |
| InChI | InChI=1S/C15H22FNO2/c1-13(2)9-15(10-18,14(3,4)19-13)17-12-7-5-6-11(16)8-12/h5-8,17-18H,9-10H2,1-4H3 |
| InChIKey | RFGAEFAEYKKRJE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |