C11H13F2N — CID 114935142
2-[(2,6-difluorophenyl)methyl]cyclobutan-1-amine (PubChem CID 114935142) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)methyl]cyclobutan-1-amine.
| Compound Name | 2-[(2,6-difluorophenyl)methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 114935142 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-[(2,6-difluorophenyl)methyl]cyclobutan-1-amine |
| SMILES | NC1CCC1Cc1c(F)cccc1F |
| InChI | InChI=1S/C11H13F2N/c12-9-2-1-3-10(13)8(9)6-7-4-5-11(7)14/h1-3,7,11H,4-6,14H2 |
| InChIKey | RNTBMNNPZCQGTQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |