C11H11BrF2S — CID 114933145
3-bromo-4-[(2,6-difluorophenyl)methyl]thiolane (PubChem CID 114933145) has the molecular formula C11H11BrF2S and a molecular weight of 293.18 g/mol. Its IUPAC name is 3-bromo-4-[(2,6-difluorophenyl)methyl]thiolane.
| Compound Name | 3-bromo-4-[(2,6-difluorophenyl)methyl]thiolane |
|---|---|
| PubChem CID | 114933145 |
| Molecular Formula | C11H11BrF2S |
| Molecular Weight | 293.18 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 3-bromo-4-[(2,6-difluorophenyl)methyl]thiolane |
| SMILES | Fc1cccc(F)c1CC1CSCC1Br |
| InChI | InChI=1S/C11H11BrF2S/c12-9-6-15-5-7(9)4-8-10(13)2-1-3-11(8)14/h1-3,7,9H,4-6H2 |
| InChIKey | BNPXAFCGLPOLEP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|