C14H17BrS — CID 83190843
3-bromo-4-(2,3-dihydro-1H-inden-5-ylmethyl)thiolane (PubChem CID 83190843) has the molecular formula C14H17BrS and a molecular weight of 297.26 g/mol. Its IUPAC name is 3-bromo-4-(2,3-dihydro-1H-inden-5-ylmethyl)thiolane.
| Compound Name | 3-bromo-4-(2,3-dihydro-1H-inden-5-ylmethyl)thiolane |
|---|---|
| PubChem CID | 83190843 |
| Molecular Formula | C14H17BrS |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 3-bromo-4-(2,3-dihydro-1H-inden-5-ylmethyl)thiolane |
| SMILES | BrC1CSCC1Cc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H17BrS/c15-14-9-16-8-13(14)7-10-4-5-11-2-1-3-12(11)6-10/h4-6,13-14H,1-3,7-9H2 |
| InChIKey | LRZHKUYLXYSETP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|