C18H16F3N5O4 — CID 11495512
4-N-methyl-7-(2-methyl-6-nitrophenyl)quinazoline-2,4-diamine;2,2,2-trifluoroacetic acid (PubChem CID 11495512) has the molecular formula C18H16F3N5O4 and a molecular weight of 423.35 g/mol. Its IUPAC name is 4-N-methyl-7-(2-methyl-6-nitrophenyl)quinazoline-2,4-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-N-methyl-7-(2-methyl-6-nitrophenyl)quinazoline-2,4-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11495512 |
| Molecular Formula | C18H16F3N5O4 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 4-N-methyl-7-(2-methyl-6-nitrophenyl)quinazoline-2,4-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CNc1nc(N)nc2cc(-c3c(C)cccc3[N+](=O)[O-])ccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H15N5O2.C2HF3O2/c1-9-4-3-5-13(21(22)23)14(9)10-6-7-11-12(8-10)19-16(17)20-15(11)18-2;3-2(4,5)1(6)7/h3-8H,1-2H3,(H3,17,18,19,20);(H,6,7) |
| InChIKey | ILXHGSPGMVUFNG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|