C27H29F2N3O3 — CID 11496692
N-cyclopropyl-3-[7-[3-(3,3-difluoropyrrolidin-1-yl)propoxy]-1-oxoisoquinolin-2-yl]-4-methylbenzamide (PubChem CID 11496692) has the molecular formula C27H29F2N3O3 and a molecular weight of 481.54 g/mol. Its IUPAC name is N-cyclopropyl-3-[7-[3-(3,3-difluoropyrrolidin-1-yl)propoxy]-1-oxoisoquinolin-2-yl]-4-methylbenzamide.
| Compound Name | N-cyclopropyl-3-[7-[3-(3,3-difluoropyrrolidin-1-yl)propoxy]-1-oxoisoquinolin-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 11496692 |
| Molecular Formula | C27H29F2N3O3 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-cyclopropyl-3-[7-[3-(3,3-difluoropyrrolidin-1-yl)propoxy]-1-oxoisoquinolin-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1-n1ccc2ccc(OCCCN3CCC(F)(F)C3)cc2c1=O |
| InChI | InChI=1S/C27H29F2N3O3/c1-18-3-4-20(25(33)30-21-6-7-21)15-24(18)32-12-9-19-5-8-22(16-23(19)26(32)34)35-14-2-11-31-13-10-27(28,29)17-31/h3-5,8-9,12,15-16,21H,2,6-7,10-11,13-14,17H2,1H3,(H,30,33) |
| InChIKey | JKXAHUDVMAGKBE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|