C28H32FN3O3 — CID 11525820
N-cyclopropyl-3-[7-[3-(3-fluoropiperidin-1-yl)propoxy]-1-oxoisoquinolin-2-yl]-4-methylbenzamide (PubChem CID 11525820) has the molecular formula C28H32FN3O3 and a molecular weight of 477.58 g/mol. Its IUPAC name is N-cyclopropyl-3-[7-[3-(3-fluoropiperidin-1-yl)propoxy]-1-oxoisoquinolin-2-yl]-4-methylbenzamide.
| Compound Name | N-cyclopropyl-3-[7-[3-(3-fluoropiperidin-1-yl)propoxy]-1-oxoisoquinolin-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 11525820 |
| Molecular Formula | C28H32FN3O3 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N-cyclopropyl-3-[7-[3-(3-fluoropiperidin-1-yl)propoxy]-1-oxoisoquinolin-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1-n1ccc2ccc(OCCCN3CCCC(F)C3)cc2c1=O |
| InChI | InChI=1S/C28H32FN3O3/c1-19-5-6-21(27(33)30-23-8-9-23)16-26(19)32-14-11-20-7-10-24(17-25(20)28(32)34)35-15-3-13-31-12-2-4-22(29)18-31/h5-7,10-11,14,16-17,22-23H,2-4,8-9,12-13,15,18H2,1H3,(H,30,33) |
| InChIKey | MIDQONKQVGGLGK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|