C24H29N3O3 — CID 11509732
N-ethyl-3-[7-[2-[ethyl(methyl)amino]ethoxy]-1-oxoisoquinolin-2-yl]-4-methylbenzamide (PubChem CID 11509732) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-ethyl-3-[7-[2-[ethyl(methyl)amino]ethoxy]-1-oxoisoquinolin-2-yl]-4-methylbenzamide.
| Compound Name | N-ethyl-3-[7-[2-[ethyl(methyl)amino]ethoxy]-1-oxoisoquinolin-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 11509732 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-ethyl-3-[7-[2-[ethyl(methyl)amino]ethoxy]-1-oxoisoquinolin-2-yl]-4-methylbenzamide |
| SMILES | CCNC(=O)c1ccc(C)c(-n2ccc3ccc(OCCN(C)CC)cc3c2=O)c1 |
| InChI | InChI=1S/C24H29N3O3/c1-5-25-23(28)19-8-7-17(3)22(15-19)27-12-11-18-9-10-20(16-21(18)24(27)29)30-14-13-26(4)6-2/h7-12,15-16H,5-6,13-14H2,1-4H3,(H,25,28) |
| InChIKey | ULMQADDNCKBQLV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |