C21H17F3N2O5S — CID 86620853
[2-[5-(cyclopropylcarbamoyl)-2-methylphenyl]-1-oxoisoquinolin-7-yl] trifluoromethanesulfonate (PubChem CID 86620853) has the molecular formula C21H17F3N2O5S and a molecular weight of 466.44 g/mol. Its IUPAC name is [2-[5-(cyclopropylcarbamoyl)-2-methylphenyl]-1-oxoisoquinolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [2-[5-(cyclopropylcarbamoyl)-2-methylphenyl]-1-oxoisoquinolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86620853 |
| Molecular Formula | C21H17F3N2O5S |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | [2-[5-(cyclopropylcarbamoyl)-2-methylphenyl]-1-oxoisoquinolin-7-yl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1-n1ccc2ccc(OS(=O)(=O)C(F)(F)F)cc2c1=O |
| InChI | InChI=1S/C21H17F3N2O5S/c1-12-2-3-14(19(27)25-15-5-6-15)10-18(12)26-9-8-13-4-7-16(11-17(13)20(26)28)31-32(29,30)21(22,23)24/h2-4,7-11,15H,5-6H2,1H3,(H,25,27) |
| InChIKey | WCMSANANMKYXJX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|